C26H34N2O3 — CID 155221881
5-[[2-(2,4-dimethylphenyl)-3H-inden-4-yl]oxy]pentyl 2,3-diamino-2-methylpropanoate (PubChem CID 155221881) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-[[2-(2,4-dimethylphenyl)-3H-inden-4-yl]oxy]pentyl 2,3-diamino-2-methylpropanoate.
| Compound Name | 5-[[2-(2,4-dimethylphenyl)-3H-inden-4-yl]oxy]pentyl 2,3-diamino-2-methylpropanoate |
|---|---|
| PubChem CID | 155221881 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 5-[[2-(2,4-dimethylphenyl)-3H-inden-4-yl]oxy]pentyl 2,3-diamino-2-methylpropanoate |
| SMILES | Cc1ccc(C2=Cc3cccc(OCCCCCOC(=O)C(C)(N)CN)c3C2)c(C)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-18-10-11-22(19(2)14-18)21-15-20-8-7-9-24(23(20)16-21)30-12-5-4-6-13-31-25(29)26(3,28)17-27/h7-11,14-15H,4-6,12-13,16-17,27-28H2,1-3H3 |
| InChIKey | XNJFTOYZUWIGCB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|