C21H24O — CID 155712236
8-pentoxy-3-phenyl-1,2-dihydronaphthalene (PubChem CID 155712236) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 8-pentoxy-3-phenyl-1,2-dihydronaphthalene.
| Compound Name | 8-pentoxy-3-phenyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 155712236 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 8-pentoxy-3-phenyl-1,2-dihydronaphthalene |
| SMILES | CCCCCOc1cccc2c1CCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C21H24O/c1-2-3-7-15-22-21-12-8-11-19-16-18(13-14-20(19)21)17-9-5-4-6-10-17/h4-6,8-12,16H,2-3,7,13-15H2,1H3 |
| InChIKey | JSFXUHWHYUJLAT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|