C29H39BrO3 — CID 155712235
2-(3-bromopropoxy)oxane;8-pentoxy-3-phenyl-1,2-dihydronaphthalene (PubChem CID 155712235) has the molecular formula C29H39BrO3 and a molecular weight of 515.53 g/mol. Its IUPAC name is 2-(3-bromopropoxy)oxane;8-pentoxy-3-phenyl-1,2-dihydronaphthalene.
| Compound Name | 2-(3-bromopropoxy)oxane;8-pentoxy-3-phenyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 155712235 |
| Molecular Formula | C29H39BrO3 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-(3-bromopropoxy)oxane;8-pentoxy-3-phenyl-1,2-dihydronaphthalene |
| SMILES | BrCCCOC1CCCCO1.CCCCCOc1cccc2c1CCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C21H24O.C8H15BrO2/c1-2-3-7-15-22-21-12-8-11-19-16-18(13-14-20(19)21)17-9-5-4-6-10-17;9-5-3-7-11-8-4-1-2-6-10-8/h4-6,8-12,16H,2-3,7,13-15H2,1H3;8H,1-7H2 |
| InChIKey | TXULRPHTQCLFJF-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|