C23H28N2O3 — CID 155221970
3-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-2-yl)oxy]propyl 2,3-diaminopropanoate (PubChem CID 155221970) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-2-yl)oxy]propyl 2,3-diaminopropanoate.
| Compound Name | 3-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-2-yl)oxy]propyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 155221970 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-[(6-phenyl-8,9-dihydro-7H-benzo[7]annulen-2-yl)oxy]propyl 2,3-diaminopropanoate |
| SMILES | NCC(N)C(=O)OCCCOc1ccc2c(c1)CCCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C23H28N2O3/c24-16-22(25)23(26)28-13-5-12-27-21-11-10-20-14-18(8-4-9-19(20)15-21)17-6-2-1-3-7-17/h1-3,6-7,10-11,14-15,22H,4-5,8-9,12-13,16,24-25H2 |
| InChIKey | BQHFIFBPUJGHJT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|