C26H28F2O3 — CID 155221899
5-[[6-(2,4-difluorophenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylprop-2-enoate (PubChem CID 155221899) has the molecular formula C26H28F2O3 and a molecular weight of 426.50 g/mol. Its IUPAC name is 5-[[6-(2,4-difluorophenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[[6-(2,4-difluorophenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155221899 |
| Molecular Formula | C26H28F2O3 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 5-[[6-(2,4-difluorophenyl)-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc2c(c1)CCCC(c1ccc(F)cc1F)=C2 |
| InChI | InChI=1S/C26H28F2O3/c1-18(2)26(29)31-14-5-3-4-13-30-23-11-9-20-15-21(8-6-7-19(20)16-23)24-12-10-22(27)17-25(24)28/h9-12,15-17H,1,3-8,13-14H2,2H3 |
| InChIKey | POXLYILOJMMCBT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|