C30H35F3O3 — CID 155222085
6-[[(5E)-6-[2-methyl-5-(trifluoromethyl)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-2-yl]oxy]hexyl 2-methylprop-2-enoate (PubChem CID 155222085) has the molecular formula C30H35F3O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 6-[[(5E)-6-[2-methyl-5-(trifluoromethyl)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-2-yl]oxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[[(5E)-6-[2-methyl-5-(trifluoromethyl)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-2-yl]oxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155222085 |
| Molecular Formula | C30H35F3O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 6-[[(5E)-6-[2-methyl-5-(trifluoromethyl)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-2-yl]oxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc2c(c1)CCCC/C(c1cc(C(F)(F)F)ccc1C)=C\2 |
| InChI | InChI=1S/C30H35F3O3/c1-21(2)29(34)36-17-9-5-4-8-16-35-27-15-13-24-18-25(11-7-6-10-23(24)19-27)28-20-26(30(31,32)33)14-12-22(28)3/h12-15,18-20H,1,4-11,16-17H2,2-3H3/b25-18+ |
| InChIKey | QGILADXSWCGZTF-XIEYBQDHSA-N |
| XLogP | 8.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|