C28H35F3N2O4 — CID 155222062
6-[[7-[2-ethyl-4-(trifluoromethoxy)phenyl]-5,6-dihydronaphthalen-2-yl]oxy]hexyl 2,3-diaminopropanoate (PubChem CID 155222062) has the molecular formula C28H35F3N2O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is 6-[[7-[2-ethyl-4-(trifluoromethoxy)phenyl]-5,6-dihydronaphthalen-2-yl]oxy]hexyl 2,3-diaminopropanoate.
| Compound Name | 6-[[7-[2-ethyl-4-(trifluoromethoxy)phenyl]-5,6-dihydronaphthalen-2-yl]oxy]hexyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 155222062 |
| Molecular Formula | C28H35F3N2O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 6-[[7-[2-ethyl-4-(trifluoromethoxy)phenyl]-5,6-dihydronaphthalen-2-yl]oxy]hexyl 2,3-diaminopropanoate |
| SMILES | CCc1cc(OC(F)(F)F)ccc1C1=Cc2cc(OCCCCCCOC(=O)C(N)CN)ccc2CC1 |
| InChI | InChI=1S/C28H35F3N2O4/c1-2-19-16-24(37-28(29,30)31)11-12-25(19)21-8-7-20-9-10-23(17-22(20)15-21)35-13-5-3-4-6-14-36-27(34)26(33)18-32/h9-12,15-17,26H,2-8,13-14,18,32-33H2,1H3 |
| InChIKey | PJLUJTGUEMTEKN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|