C27H29F3O4 — CID 155222087
3-[[(5E)-6-[5-ethyl-2-(trifluoromethoxy)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-3-yl]oxy]propyl prop-2-enoate (PubChem CID 155222087) has the molecular formula C27H29F3O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[[(5E)-6-[5-ethyl-2-(trifluoromethoxy)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-3-yl]oxy]propyl prop-2-enoate.
| Compound Name | 3-[[(5E)-6-[5-ethyl-2-(trifluoromethoxy)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-3-yl]oxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 155222087 |
| Molecular Formula | C27H29F3O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 3-[[(5E)-6-[5-ethyl-2-(trifluoromethoxy)phenyl]-7,8,9,10-tetrahydrobenzo[8]annulen-3-yl]oxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc2c(c1)/C=C(/c1cc(CC)ccc1OC(F)(F)F)CCCC2 |
| InChI | InChI=1S/C27H29F3O4/c1-3-19-10-13-25(34-27(28,29)30)24(16-19)21-9-6-5-8-20-11-12-23(18-22(20)17-21)32-14-7-15-33-26(31)4-2/h4,10-13,16-18H,2-3,5-9,14-15H2,1H3/b21-17+ |
| InChIKey | IYOAHPBSYHPRQM-HEHNFIMWSA-N |
| XLogP | 6.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|