C27H26F3NO4 — CID 155712277
5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl prop-2-enoate (PubChem CID 155712277) has the molecular formula C27H26F3NO4 and a molecular weight of 485.50 g/mol. Its IUPAC name is 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl prop-2-enoate.
| Compound Name | 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 155712277 |
| Molecular Formula | C27H26F3NO4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 5-[[5-cyano-6-[3-(trifluoromethoxy)phenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]oxy]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc2c(c1)CCCC(c1cccc(OC(F)(F)F)c1)=C2C#N |
| InChI | InChI=1S/C27H26F3NO4/c1-2-26(32)34-15-5-3-4-14-33-21-12-13-24-19(16-21)9-7-11-23(25(24)18-31)20-8-6-10-22(17-20)35-27(28,29)30/h2,6,8,10,12-13,16-17H,1,3-5,7,9,11,14-15H2 |
| InChIKey | CWICQQCFOMWGIS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|