C24H26O3 — CID 155222238
4-[(5-phenyl-8,9-dihydro-7H-benzo[7]annulen-3-yl)oxy]butyl prop-2-enoate (PubChem CID 155222238) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[(5-phenyl-8,9-dihydro-7H-benzo[7]annulen-3-yl)oxy]butyl prop-2-enoate.
| Compound Name | 4-[(5-phenyl-8,9-dihydro-7H-benzo[7]annulen-3-yl)oxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 155222238 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-[(5-phenyl-8,9-dihydro-7H-benzo[7]annulen-3-yl)oxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc2c(c1)C(c1ccccc1)=CCCC2 |
| InChI | InChI=1S/C24H26O3/c1-2-24(25)27-17-9-8-16-26-21-15-14-20-12-6-7-13-22(23(20)18-21)19-10-4-3-5-11-19/h2-5,10-11,13-15,18H,1,6-9,12,16-17H2 |
| InChIKey | FPFTXZHQMISUII-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|