C33H32O8 — CID 90393287
[4-[(4-ethylphenyl)-hydroperoxymethyl]-2-(hydroxymethyl)phenyl] 6-(3-prop-2-enoyloxypropoxy)naphthalene-2-carboxylate (PubChem CID 90393287) has the molecular formula C33H32O8 and a molecular weight of 556.61 g/mol. Its IUPAC name is [4-[(4-ethylphenyl)-hydroperoxymethyl]-2-(hydroxymethyl)phenyl] 6-(3-prop-2-enoyloxypropoxy)naphthalene-2-carboxylate.
| Compound Name | [4-[(4-ethylphenyl)-hydroperoxymethyl]-2-(hydroxymethyl)phenyl] 6-(3-prop-2-enoyloxypropoxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90393287 |
| Molecular Formula | C33H32O8 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | [4-[(4-ethylphenyl)-hydroperoxymethyl]-2-(hydroxymethyl)phenyl] 6-(3-prop-2-enoyloxypropoxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCOc1ccc2cc(C(=O)Oc3ccc(C(OO)c4ccc(CC)cc4)cc3CO)ccc2c1 |
| InChI | InChI=1S/C33H32O8/c1-3-22-6-8-23(9-7-22)32(41-37)26-13-15-30(28(19-26)21-34)40-33(36)27-11-10-25-20-29(14-12-24(25)18-27)38-16-5-17-39-31(35)4-2/h4,6-15,18-20,32,34,37H,2-3,5,16-17,21H2,1H3 |
| InChIKey | SOUUMDKIBMLJQJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|