C31H42F2N2O3S — CID 162608915
[7-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate (PubChem CID 162608915) has the molecular formula C31H42F2N2O3S and a molecular weight of 560.75 g/mol. Its IUPAC name is [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate.
| Compound Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 162608915 |
| Molecular Formula | C31H42F2N2O3S |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCCC(F)(F)CCCOC(=O)C(N)CN)cc3s2)c(CC)c1 |
| InChI | InChI=1S/C31H42F2N2O3S/c1-3-5-6-9-22-10-13-26(23(4-2)18-22)29-19-24-11-12-25(20-28(24)39-29)37-16-7-14-31(32,33)15-8-17-38-30(36)27(35)21-34/h10-13,18-20,27H,3-9,14-17,21,34-35H2,1-2H3 |
| InChIKey | PPTKRZYDMJXYGX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|