C31H36F2O4S — CID 161332132
[4,4-difluoro-7-[3-(2-methyl-4-pentylphenyl)-2-oxothiochromen-7-yl]oxyheptyl] prop-2-enoate (PubChem CID 161332132) has the molecular formula C31H36F2O4S and a molecular weight of 542.69 g/mol. Its IUPAC name is [4,4-difluoro-7-[3-(2-methyl-4-pentylphenyl)-2-oxothiochromen-7-yl]oxyheptyl] prop-2-enoate.
| Compound Name | [4,4-difluoro-7-[3-(2-methyl-4-pentylphenyl)-2-oxothiochromen-7-yl]oxyheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 161332132 |
| Molecular Formula | C31H36F2O4S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | [4,4-difluoro-7-[3-(2-methyl-4-pentylphenyl)-2-oxothiochromen-7-yl]oxyheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(F)(F)CCCOc1ccc2cc(-c3ccc(CCCCC)cc3C)c(=O)sc2c1 |
| InChI | InChI=1S/C31H36F2O4S/c1-4-6-7-10-23-11-14-26(22(3)19-23)27-20-24-12-13-25(21-28(24)38-30(27)35)36-17-8-15-31(32,33)16-9-18-37-29(34)5-2/h5,11-14,19-21H,2,4,6-10,15-18H2,1,3H3 |
| InChIKey | XHRRXIDHEONONU-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|