C21H19F3O3S2 — CID 146221015
7-hydroxysulfanyloxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-2-one (PubChem CID 146221015) has the molecular formula C21H19F3O3S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 7-hydroxysulfanyloxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-2-one.
| Compound Name | 7-hydroxysulfanyloxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-2-one |
|---|---|
| PubChem CID | 146221015 |
| Molecular Formula | C21H19F3O3S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 7-hydroxysulfanyloxy-3-[4-pentyl-2-(trifluoromethyl)phenyl]thiochromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OSO)cc3sc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H19F3O3S2/c1-2-3-4-5-13-6-9-16(18(10-13)21(22,23)24)17-11-14-7-8-15(27-29-26)12-19(14)28-20(17)25/h6-12,26H,2-5H2,1H3 |
| InChIKey | QUWDYVCNLMBRPH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|