C41H49F11O5 — CID 155262656
[3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxyoctyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155262656) has the molecular formula C41H49F11O5 and a molecular weight of 830.82 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxyoctyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxyoctyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155262656 |
| Molecular Formula | C41H49F11O5 |
| Molecular Weight | 830.82 g/mol |
| Exact Mass | 830.34 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxyoctyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C41H49F11O5/c1-9-10-11-12-25-13-16-28(30(21-25)39(46,47)48)29-22-26-14-15-27(23-31(26)57-32(29)53)55-19-17-37(42,43)40(49,50)41(51,52)38(44,45)18-20-56-33(54)36(8,35(5,6)7)24-34(2,3)4/h13-16,21-23H,9-12,17-20,24H2,1-8H3 |
| InChIKey | NSPXNNGAPBAHBI-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.82 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|