C35H39F11N2O6 — CID 155262667
[3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxyoctyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate (PubChem CID 155262667) has the molecular formula C35H39F11N2O6 and a molecular weight of 792.68 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxyoctyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxyoctyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155262667 |
| Molecular Formula | C35H39F11N2O6 |
| Molecular Weight | 792.68 g/mol |
| Exact Mass | 792.26 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxyoctyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
| SMILES | COc1ccc(-c2cc3ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C(C)(CC(C)(C)N)C(C)(C)N)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H39F11N2O6/c1-28(2,47)18-30(5,29(3,4)48)27(50)53-14-12-32(38,39)35(45,46)34(43,44)31(36,37)11-13-52-21-8-7-19-15-23(26(49)54-25(19)17-21)22-10-9-20(51-6)16-24(22)33(40,41)42/h7-10,15-17H,11-14,18,47-48H2,1-6H3 |
| InChIKey | KNYRKBPFCLFJSO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.68 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|