C32H35F9N2O6 — CID 162570845
[2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate (PubChem CID 162570845) has the molecular formula C32H35F9N2O6 and a molecular weight of 714.62 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 162570845 |
| Molecular Formula | C32H35F9N2O6 |
| Molecular Weight | 714.62 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
| SMILES | COc1ccc(-c2cc3ccc(OCC(F)(F)C(F)(F)C(F)(F)COC(=O)C(C)(CC(C)(C)N)C(C)(C)N)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H35F9N2O6/c1-26(2,42)14-28(5,27(3,4)43)25(45)48-16-30(35,36)32(40,41)29(33,34)15-47-19-8-7-17-11-21(24(44)49-23(17)13-19)20-10-9-18(46-6)12-22(20)31(37,38)39/h7-13H,14-16,42-43H2,1-6H3 |
| InChIKey | FTZJMWPVCBDCBB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|