C31H33F9N2O6 — CID 155262502
[2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-4-methylpentanoate (PubChem CID 155262502) has the molecular formula C31H33F9N2O6 and a molecular weight of 700.60 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-4-methylpentanoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 155262502 |
| Molecular Formula | C31H33F9N2O6 |
| Molecular Weight | 700.60 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[3-[4-methoxy-2-(trifluoromethyl)phenyl]-2-oxochromen-7-yl]oxypentyl] 4-amino-2-(2-aminopropan-2-yl)-4-methylpentanoate |
| SMILES | COc1ccc(-c2cc3ccc(OCC(F)(F)C(F)(F)C(F)(F)COC(=O)C(CC(C)(C)N)C(C)(C)N)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H33F9N2O6/c1-26(2,41)13-22(27(3,4)42)25(44)47-15-29(34,35)31(39,40)28(32,33)14-46-18-7-6-16-10-20(24(43)48-23(16)12-18)19-9-8-17(45-5)11-21(19)30(36,37)38/h6-12,22H,13-15,41-42H2,1-5H3 |
| InChIKey | CWJMREYGKFVNBQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|