C33H38F6O5 — CID 155262467
[5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 155262467) has the molecular formula C33H38F6O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155262467 |
| Molecular Formula | C33H38F6O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CCc1ccccc1-c1cc2ccc(OCC(F)(F)C(F)(F)C(F)(F)COC(=O)C(C)(CC(C)C)C(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C33H38F6O5/c1-8-21-11-9-10-12-24(21)25-15-22-13-14-23(16-26(22)44-27(25)40)42-18-31(34,35)33(38,39)32(36,37)19-43-28(41)30(7,17-20(2)3)29(4,5)6/h9-16,20H,8,17-19H2,1-7H3 |
| InChIKey | LOSHJVUQCVNWLL-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|