C26H22F6O5 — CID 153306096
[5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate (PubChem CID 153306096) has the molecular formula C26H22F6O5 and a molecular weight of 528.45 g/mol. Its IUPAC name is [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153306096 |
| Molecular Formula | C26H22F6O5 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [5-[3-(2-ethylphenyl)-2-oxochromen-7-yl]oxy-2,2,3,3,4,4-hexafluoropentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccccc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C26H22F6O5/c1-4-16-7-5-6-8-19(16)20-11-17-9-10-18(12-21(17)37-23(20)34)35-13-24(27,28)26(31,32)25(29,30)14-36-22(33)15(2)3/h5-12H,2,4,13-14H2,1,3H3 |
| InChIKey | WLZKITKFGAMVDW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|