C26H25F3O4 — CID 146390990
[3-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 146390990) has the molecular formula C26H25F3O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is [3-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390990 |
| Molecular Formula | C26H25F3O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [3-[[2-(2-ethylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Oc2ccc3cc(-c4ccccc4CC)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C26H25F3O4/c1-4-16-7-5-6-8-19(16)23-13-17-9-10-18(14-22(17)32-23)31-20-11-12-21(24(20)26(27,28)29)33-25(30)15(2)3/h5-10,13-14,20-21,24H,2,4,11-12H2,1,3H3 |
| InChIKey | DNUXWMIVTVYOEM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|