C29H31F3O5 — CID 146390582
[3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] prop-2-enoate (PubChem CID 146390582) has the molecular formula C29H31F3O5 and a molecular weight of 516.56 g/mol. Its IUPAC name is [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] prop-2-enoate.
| Compound Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390582 |
| Molecular Formula | C29H31F3O5 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(Oc2ccc3cc(-c4ccc(CCCCC)cc4OC)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C29H31F3O5/c1-4-6-7-8-18-9-12-21(25(15-18)34-3)26-16-19-10-11-20(17-24(19)36-26)35-22-13-14-23(37-27(33)5-2)28(22)29(30,31)32/h5,9-12,15-17,22-23,28H,2,4,6-8,13-14H2,1,3H3 |
| InChIKey | OJURVHMFGYHFOR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|