C30H38O6 — CID 154601578
[5-(hydroxymethyl)-6-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]hexyl] prop-2-enoate (PubChem CID 154601578) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [5-(hydroxymethyl)-6-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]hexyl] prop-2-enoate.
| Compound Name | [5-(hydroxymethyl)-6-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]hexyl] prop-2-enoate |
|---|---|
| PubChem CID | 154601578 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [5-(hydroxymethyl)-6-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]hexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCCC(CO)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)oc2c1 |
| InChI | InChI=1S/C30H38O6/c1-4-6-7-10-22-12-15-26(28(17-22)33-3)29-18-24-13-14-25(19-27(24)36-29)35-21-23(20-31)11-8-9-16-34-30(32)5-2/h5,12-15,17-19,23,31H,2,4,6-11,16,20-21H2,1,3H3 |
| InChIKey | YQGBFDZTCUQHCY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|