C32H42O6 — CID 154601477
[4,5-dihydroxy-8-[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]octyl] 2-methylprop-2-enoate (PubChem CID 154601477) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]octyl] 2-methylprop-2-enoate.
| Compound Name | [4,5-dihydroxy-8-[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154601477 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [4,5-dihydroxy-8-[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(O)C(O)CCCc1ccc2cc(-c3ccc(CCCCC)cc3OC)oc2c1 |
| InChI | InChI=1S/C32H42O6/c1-5-6-7-10-23-15-17-26(30(20-23)36-4)31-21-25-16-14-24(19-29(25)38-31)11-8-12-27(33)28(34)13-9-18-37-32(35)22(2)3/h14-17,19-21,27-28,33-34H,2,5-13,18H2,1,3-4H3 |
| InChIKey | LXOZLRJRPSHSMQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|