C29H33F3O4S — CID 146390920
[4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-methylprop-2-enoate (PubChem CID 146390920) has the molecular formula C29H33F3O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390920 |
| Molecular Formula | C29H33F3O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CSc1ccc2cc(-c3ccc(CCCCC)cc3OC)oc2c1)CC(F)(F)F |
| InChI | InChI=1S/C29H33F3O4S/c1-5-6-7-8-20-9-12-24(26(13-20)34-4)27-14-22-10-11-23(15-25(22)36-27)37-18-21(16-29(30,31)32)17-35-28(33)19(2)3/h9-15,21H,2,5-8,16-18H2,1,3-4H3 |
| InChIKey | SALVYFHZBMOBTF-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|