C35H42F6O3S — CID 155265760
[4,4,4-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-tert-butyl-4-methylpent-3-enoate (PubChem CID 155265760) has the molecular formula C35H42F6O3S and a molecular weight of 656.77 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-tert-butyl-4-methylpent-3-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-tert-butyl-4-methylpent-3-enoate |
|---|---|
| PubChem CID | 155265760 |
| Molecular Formula | C35H42F6O3S |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | [4,4,4-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]butyl] 2-tert-butyl-4-methylpent-3-enoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCC(COC(=O)C(C=C(C)C)C(C)(C)C)CC(F)(F)F)cc3o2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H42F6O3S/c1-7-8-9-10-23-11-14-27(28(16-23)35(39,40)41)31-17-25-12-13-26(18-30(25)44-31)45-21-24(19-34(36,37)38)20-43-32(42)29(15-22(2)3)33(4,5)6/h11-18,24,29H,7-10,19-21H2,1-6H3 |
| InChIKey | ROQUGXCZFUVODY-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|