C30H37F3O5 — CID 155238658
[2-hydroxy-6-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 2-methylpropanoate (PubChem CID 155238658) has the molecular formula C30H37F3O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is [2-hydroxy-6-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 2-methylpropanoate.
| Compound Name | [2-hydroxy-6-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 155238658 |
| Molecular Formula | C30H37F3O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [2-hydroxy-6-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 2-methylpropanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCCCC(O)COC(=O)C(C)C)cc3o2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H37F3O5/c1-4-5-6-9-21-11-14-25(26(16-21)30(31,32)33)28-17-22-12-13-24(18-27(22)38-28)36-15-8-7-10-23(34)19-37-29(35)20(2)3/h11-14,16-18,20,23,34H,4-10,15,19H2,1-3H3 |
| InChIKey | OOYVEYOZVBQIGG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|