C30H32F6O5S — CID 148851857
[4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl]butyl] 2-methylpropanoate (PubChem CID 148851857) has the molecular formula C30H32F6O5S and a molecular weight of 618.64 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl]butyl] 2-methylpropanoate.
| Compound Name | [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl]butyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 148851857 |
| Molecular Formula | C30H32F6O5S |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [4,4,4-trifluoro-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl]butyl] 2-methylpropanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCC(COC(=O)C(C)C)CC(F)(F)F)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C30H32F6O5S/c1-4-5-6-7-19-8-11-23(26(12-19)41-30(34,35)36)24-13-21-9-10-22(14-25(21)40-28(24)38)42-17-20(15-29(31,32)33)16-39-27(37)18(2)3/h8-14,18,20H,4-7,15-17H2,1-3H3 |
| InChIKey | OXPKGVCZRNKVMW-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|