C38H51F5N2O5S — CID 155262726
[4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate (PubChem CID 155262726) has the molecular formula C38H51F5N2O5S and a molecular weight of 742.89 g/mol. Its IUPAC name is [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate.
| Compound Name | [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155262726 |
| Molecular Formula | C38H51F5N2O5S |
| Molecular Weight | 742.89 g/mol |
| Exact Mass | 742.34 |
| IUPAC Name | [4,4-difluoro-7-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylheptyl] 4-amino-2-(2-aminopropan-2-yl)-2,4-dimethylpentanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCCCC(F)(F)CCCOC(=O)C(C)(CC(C)(C)N)C(C)(C)N)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C38H51F5N2O5S/c1-7-8-9-12-25-13-16-28(31(21-25)50-38(41,42)43)29-22-26-14-15-27(23-30(26)49-32(29)46)51-20-11-18-37(39,40)17-10-19-48-33(47)36(6,35(4,5)45)24-34(2,3)44/h13-16,21-23H,7-12,17-20,24,44-45H2,1-6H3 |
| InChIKey | KZEDHMZKOQQEJZ-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.89 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|