C33H31F11O6 — CID 153306075
[3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] 2-methylprop-2-enoate (PubChem CID 153306075) has the molecular formula C33H31F11O6 and a molecular weight of 732.58 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153306075 |
| Molecular Formula | C33H31F11O6 |
| Molecular Weight | 732.58 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxyoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C33H31F11O6/c1-4-5-6-7-20-8-11-23(26(16-20)50-33(42,43)44)24-17-21-9-10-22(18-25(21)49-28(24)46)47-14-12-29(34,35)31(38,39)32(40,41)30(36,37)13-15-48-27(45)19(2)3/h8-11,16-18H,2,4-7,12-15H2,1,3H3 |
| InChIKey | XZCPMFRQIZTTSS-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.58 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|