C28H23F9O9 — CID 153306152
[3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate (PubChem CID 153306152) has the molecular formula C28H23F9O9 and a molecular weight of 674.46 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153306152 |
| Molecular Formula | C28H23F9O9 |
| Molecular Weight | 674.46 g/mol |
| Exact Mass | 674.12 |
| IUPAC Name | [3-[[1,1-difluoro-3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxypropoxy]-difluoromethoxy]-3,3-difluoropropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)OC(F)(F)OC(F)(F)CCOc1ccc2cc(-c3ccc(OC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C28H23F9O9/c1-15(2)23(38)42-11-9-26(31,32)46-28(36,37)45-25(29,30)8-10-41-18-5-4-16-12-20(24(39)43-21(16)14-18)19-7-6-17(40-3)13-22(19)44-27(33,34)35/h4-7,12-14H,1,8-11H2,2-3H3 |
| InChIKey | REULRNKRCZSROC-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.46 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|