C26H22F6O7 — CID 153306074
[4,4,4-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]-2-methylbutyl] prop-2-enoate (PubChem CID 153306074) has the molecular formula C26H22F6O7 and a molecular weight of 560.44 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]-2-methylbutyl] prop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]-2-methylbutyl] prop-2-enoate |
|---|---|
| PubChem CID | 153306074 |
| Molecular Formula | C26H22F6O7 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | [4,4,4-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]-2-methylbutyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COc1ccc2cc(-c3ccc(OC)cc3OC(F)(F)F)c(=O)oc2c1)CC(F)(F)F |
| InChI | InChI=1S/C26H22F6O7/c1-4-22(33)37-14-24(2,12-25(27,28)29)13-36-17-6-5-15-9-19(23(34)38-20(15)11-17)18-8-7-16(35-3)10-21(18)39-26(30,31)32/h4-11H,1,12-14H2,2-3H3 |
| InChIKey | MSMBXXMTISZGPM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|