C49H50F6O9 — CID 155236244
7-[5-hydroxy-2,4,4,6,6,8-hexamethyl-8-[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxynonan-2-yl]oxy-3-[4-methyl-2-(trifluoromethoxy)phenyl]chromen-2-one (PubChem CID 155236244) has the molecular formula C49H50F6O9 and a molecular weight of 896.92 g/mol. Its IUPAC name is 7-[5-hydroxy-2,4,4,6,6,8-hexamethyl-8-[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxynonan-2-yl]oxy-3-[4-methyl-2-(trifluoromethoxy)phenyl]chromen-2-one.
| Compound Name | 7-[5-hydroxy-2,4,4,6,6,8-hexamethyl-8-[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxynonan-2-yl]oxy-3-[4-methyl-2-(trifluoromethoxy)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 155236244 |
| Molecular Formula | C49H50F6O9 |
| Molecular Weight | 896.92 g/mol |
| Exact Mass | 896.34 |
| IUPAC Name | 7-[5-hydroxy-2,4,4,6,6,8-hexamethyl-8-[3-[4-methyl-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxynonan-2-yl]oxy-3-[4-methyl-2-(trifluoromethoxy)phenyl]chromen-2-one |
| SMILES | Cc1ccc(-c2cc3ccc(OC(C)(C)CC(C)(C)C(O)C(C)(C)CC(C)(C)Oc4ccc5cc(-c6ccc(C)cc6OC(F)(F)F)c(=O)oc5c4)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C49H50F6O9/c1-27-11-17-33(39(19-27)63-48(50,51)52)35-21-29-13-15-31(23-37(29)59-41(35)56)61-46(7,8)25-44(3,4)43(58)45(5,6)26-47(9,10)62-32-16-14-30-22-36(42(57)60-38(30)24-32)34-18-12-28(2)20-40(34)64-49(53,54)55/h11-24,43,58H,25-26H2,1-10H3 |
| InChIKey | PZYRUXQURBZGQE-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.92 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|