C37H52O5 — CID 126606440
[4-[3-(2,4-diethylphenyl)-2-oxochromen-7-yl]oxy-2,4-dimethylpentan-2-yl] 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 126606440) has the molecular formula C37H52O5 and a molecular weight of 576.82 g/mol. Its IUPAC name is [4-[3-(2,4-diethylphenyl)-2-oxochromen-7-yl]oxy-2,4-dimethylpentan-2-yl] 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | [4-[3-(2,4-diethylphenyl)-2-oxochromen-7-yl]oxy-2,4-dimethylpentan-2-yl] 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 126606440 |
| Molecular Formula | C37H52O5 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | [4-[3-(2,4-diethylphenyl)-2-oxochromen-7-yl]oxy-2,4-dimethylpentan-2-yl] 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CCc1ccc(-c2cc3ccc(OC(C)(C)CC(C)(C)OC(=O)C(CC(C)(C)C)C(C)(C)C)cc3oc2=O)c(CC)c1 |
| InChI | InChI=1S/C37H52O5/c1-13-24-15-18-28(25(14-2)19-24)29-20-26-16-17-27(21-31(26)40-32(29)38)41-36(9,10)23-37(11,12)42-33(39)30(35(6,7)8)22-34(3,4)5/h15-21,30H,13-14,22-23H2,1-12H3 |
| InChIKey | CWBDZQDSPHYFAL-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|