C33H46O6 — CID 155238656
[4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 155238656) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155238656 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [4,5-dihydroxy-8-[(2-phenyl-1-benzofuran-6-yl)oxy]octyl] 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)OCCCC(O)C(O)CCCOc1ccc2cc(-c3ccccc3)oc2c1)C(C)(C)C |
| InChI | InChI=1S/C33H46O6/c1-32(2,3)22-26(33(4,5)6)31(36)38-19-11-15-28(35)27(34)14-10-18-37-25-17-16-24-20-29(39-30(24)21-25)23-12-8-7-9-13-23/h7-9,12-13,16-17,20-21,26-28,34-35H,10-11,14-15,18-19,22H2,1-6H3 |
| InChIKey | NZADRBIPOSKRHU-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|