C39H58O6 — CID 155238643
[4,5-dihydroxy-8-[4-(6-pentyl-1-benzofuran-2-yl)phenoxy]octyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155238643) has the molecular formula C39H58O6 and a molecular weight of 622.89 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[4-(6-pentyl-1-benzofuran-2-yl)phenoxy]octyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [4,5-dihydroxy-8-[4-(6-pentyl-1-benzofuran-2-yl)phenoxy]octyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155238643 |
| Molecular Formula | C39H58O6 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | [4,5-dihydroxy-8-[4-(6-pentyl-1-benzofuran-2-yl)phenoxy]octyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCCCCc1ccc2cc(-c3ccc(OCCCC(O)C(O)CCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc3)oc2c1 |
| InChI | InChI=1S/C39H58O6/c1-9-10-11-14-28-17-18-30-26-35(45-34(30)25-28)29-19-21-31(22-20-29)43-23-12-15-32(40)33(41)16-13-24-44-36(42)39(8,38(5,6)7)27-37(2,3)4/h17-22,25-26,32-33,40-41H,9-16,23-24,27H2,1-8H3 |
| InChIKey | RHFDJDWBQBHSPM-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|