C33H47NO5 — CID 155238625
[6-[[2-(4-ethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-5-hydroxyhexyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155238625) has the molecular formula C33H47NO5 and a molecular weight of 537.74 g/mol. Its IUPAC name is [6-[[2-(4-ethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-5-hydroxyhexyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [6-[[2-(4-ethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-5-hydroxyhexyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155238625 |
| Molecular Formula | C33H47NO5 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.35 |
| IUPAC Name | [6-[[2-(4-ethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-5-hydroxyhexyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCc1ccncc1-c1cc2ccc(OCC(O)CCCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc2o1 |
| InChI | InChI=1S/C33H47NO5/c1-9-23-15-16-34-20-27(23)29-18-24-13-14-26(19-28(24)39-29)38-21-25(35)12-10-11-17-37-30(36)33(8,32(5,6)7)22-31(2,3)4/h13-16,18-20,25,35H,9-12,17,21-22H2,1-8H3 |
| InChIKey | PUQMJTZKGZAENE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|