C37H49F3I2O7 — CID 155238634
[5-hydroxy-2-(hydroxymethyl)-6-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 4-iodo-2-(2-iodopropan-2-yl)-2,4-dimethylpentanoate (PubChem CID 155238634) has the molecular formula C37H49F3I2O7 and a molecular weight of 916.59 g/mol. Its IUPAC name is [5-hydroxy-2-(hydroxymethyl)-6-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 4-iodo-2-(2-iodopropan-2-yl)-2,4-dimethylpentanoate.
| Compound Name | [5-hydroxy-2-(hydroxymethyl)-6-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 4-iodo-2-(2-iodopropan-2-yl)-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 155238634 |
| Molecular Formula | C37H49F3I2O7 |
| Molecular Weight | 916.59 g/mol |
| Exact Mass | 916.15 |
| IUPAC Name | [5-hydroxy-2-(hydroxymethyl)-6-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]hexyl] 4-iodo-2-(2-iodopropan-2-yl)-2,4-dimethylpentanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(O)CCC(CO)COC(=O)C(C)(CC(C)(C)I)C(C)(C)I)cc3o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C37H49F3I2O7/c1-7-8-9-10-24-12-16-29(32(17-24)49-37(38,39)40)31-18-26-13-15-28(19-30(26)48-31)46-22-27(44)14-11-25(20-43)21-47-33(45)36(6,35(4,5)42)23-34(2,3)41/h12-13,15-19,25,27,43-44H,7-11,14,20-23H2,1-6H3 |
| InChIKey | RKXGXGXQYAEXLB-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.59 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|