C35H49F3N2O5 — CID 147262763
[4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxymethyl]-2-methylbutyl] 3,5-diamino-2,2,5-trimethylhexanoate (PubChem CID 147262763) has the molecular formula C35H49F3N2O5 and a molecular weight of 634.78 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxymethyl]-2-methylbutyl] 3,5-diamino-2,2,5-trimethylhexanoate.
| Compound Name | [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxymethyl]-2-methylbutyl] 3,5-diamino-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 147262763 |
| Molecular Formula | C35H49F3N2O5 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | [4,4,4-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxymethyl]-2-methylbutyl] 3,5-diamino-2,2,5-trimethylhexanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(C)(COC(=O)C(C)(C)C(N)CC(C)(C)N)CC(F)(F)F)cc3o2)c(OC)c1 |
| InChI | InChI=1S/C35H49F3N2O5/c1-8-9-10-11-23-12-15-26(28(16-23)42-7)29-17-24-13-14-25(18-27(24)45-29)43-21-34(6,20-35(36,37)38)22-44-31(41)33(4,5)30(39)19-32(2,3)40/h12-18,30H,8-11,19-22,39-40H2,1-7H3 |
| InChIKey | COWRVEZFKTZWCU-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|