C21H21F3O3 — CID 146391174
6-methoxy-2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran (PubChem CID 146391174) has the molecular formula C21H21F3O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 6-methoxy-2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran.
| Compound Name | 6-methoxy-2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran |
|---|---|
| PubChem CID | 146391174 |
| Molecular Formula | C21H21F3O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 6-methoxy-2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OC)cc3o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3O3/c1-3-4-5-6-14-7-10-17(20(11-14)27-21(22,23)24)19-12-15-8-9-16(25-2)13-18(15)26-19/h7-13H,3-6H2,1-2H3 |
| InChIKey | YARZQPYUXZGHFK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|