C35H44F8N2O7S — CID 155265492
[2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,5-trimethylhexanoate (PubChem CID 155265492) has the molecular formula C35H44F8N2O7S and a molecular weight of 788.79 g/mol. Its IUPAC name is [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,5-trimethylhexanoate.
| Compound Name | [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 155265492 |
| Molecular Formula | C35H44F8N2O7S |
| Molecular Weight | 788.79 g/mol |
| Exact Mass | 788.27 |
| IUPAC Name | [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,5-trimethylhexanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)COC(=O)C(C)(C)C(N)CC(C)(C)N)cc3s2)c(OC)c1 |
| InChI | InChI=1S/C35H44F8N2O7S/c1-7-8-9-10-21-11-14-24(25(15-21)47-6)27-16-22-12-13-23(17-26(22)53-27)48-19-32(36,37)50-34(40,41)52-35(42,43)51-33(38,39)20-49-29(46)31(4,5)28(44)18-30(2,3)45/h11-17,28H,7-10,18-20,44-45H2,1-6H3 |
| InChIKey | FPNLBWZMKZSCAP-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.79 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|