C28H34O5 — CID 160898067
[3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 160898067) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160898067 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)oc2c1 |
| InChI | InChI=1S/C28H34O5/c1-6-7-8-9-21-10-13-24(26(14-21)30-5)27-15-22-11-12-23(16-25(22)33-27)31-17-20(4)18-32-28(29)19(2)3/h10-16,20H,2,6-9,17-18H2,1,3-5H3 |
| InChIKey | GWVGDZCMMUMZHZ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|