C32H43NO4 — CID 158932714
[3-[2-(2-methoxy-4-pentylphenyl)-1-(2-methylpropyl)indol-6-yl]oxy-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 158932714) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is [3-[2-(2-methoxy-4-pentylphenyl)-1-(2-methylpropyl)indol-6-yl]oxy-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-(2-methoxy-4-pentylphenyl)-1-(2-methylpropyl)indol-6-yl]oxy-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158932714 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | [3-[2-(2-methoxy-4-pentylphenyl)-1-(2-methylpropyl)indol-6-yl]oxy-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(CC(C)C)c2c1 |
| InChI | InChI=1S/C32H43NO4/c1-8-9-10-11-25-12-15-28(31(16-25)35-7)30-17-26-13-14-27(18-29(26)33(30)19-22(2)3)36-20-24(6)21-37-32(34)23(4)5/h12-18,22,24H,4,8-11,19-21H2,1-3,5-7H3 |
| InChIKey | NNQVTVBRZBSPGN-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|