C33H42F3NO4 — CID 146391037
[3,3,3-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxymethyl]propyl] prop-2-enoate (PubChem CID 146391037) has the molecular formula C33H42F3NO4 and a molecular weight of 573.70 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxymethyl]propyl] prop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxymethyl]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 146391037 |
| Molecular Formula | C33H42F3NO4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | [3,3,3-trifluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-(4-methylpentyl)indol-6-yl]oxymethyl]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(CCCC(C)C)c2c1)C(F)(F)F |
| InChI | InChI=1S/C33H42F3NO4/c1-6-8-9-12-24-13-16-28(31(18-24)39-5)30-19-25-14-15-27(20-29(25)37(30)17-10-11-23(3)4)40-21-26(33(34,35)36)22-41-32(38)7-2/h7,13-16,18-20,23,26H,2,6,8-12,17,21-22H2,1,3-5H3 |
| InChIKey | BSKDFNVTMPMPEW-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|