C31H32F9NO4 — CID 146390979
[2,2,3,3,4,4-hexafluoro-5-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxypentyl] prop-2-enoate (PubChem CID 146390979) has the molecular formula C31H32F9NO4 and a molecular weight of 653.58 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxypentyl] prop-2-enoate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxypentyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390979 |
| Molecular Formula | C31H32F9NO4 |
| Molecular Weight | 653.58 g/mol |
| Exact Mass | 653.22 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-propan-2-ylindol-6-yl]oxypentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)n(C(C)C)c2c1 |
| InChI | InChI=1S/C31H32F9NO4/c1-5-7-8-9-20-10-13-23(26(14-20)45-31(38,39)40)25-15-21-11-12-22(16-24(21)41(25)19(3)4)43-17-28(32,33)30(36,37)29(34,35)18-44-27(42)6-2/h6,10-16,19H,2,5,7-9,17-18H2,1,3-4H3 |
| InChIKey | XBRJWIMGUJOUPX-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.58 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|