C33H38F6O5 — CID 155262382
[4,4,4-trifluoro-2-methyl-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 3,3-dimethylbutanoate (PubChem CID 155262382) has the molecular formula C33H38F6O5 and a molecular weight of 628.65 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-methyl-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 3,3-dimethylbutanoate.
| Compound Name | [4,4,4-trifluoro-2-methyl-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 155262382 |
| Molecular Formula | C33H38F6O5 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [4,4,4-trifluoro-2-methyl-2-[[2-oxo-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-7-yl]oxymethyl]butyl] 3,3-dimethylbutanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(C)(COC(=O)CC(C)(C)C)CC(F)(F)F)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H38F6O5/c1-6-7-8-9-21-10-13-24(26(14-21)33(37,38)39)25-15-22-11-12-23(16-27(22)44-29(25)41)42-19-31(5,18-32(34,35)36)20-43-28(40)17-30(2,3)4/h10-16H,6-9,17-20H2,1-5H3 |
| InChIKey | ZSTYLAYYTDVOAG-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|