C31H37F3O5 — CID 155262685
[3,3,3-trifluoro-2-[(2-oxo-3-phenylchromen-7-yl)oxymethyl]propyl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 155262685) has the molecular formula C31H37F3O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[(2-oxo-3-phenylchromen-7-yl)oxymethyl]propyl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [3,3,3-trifluoro-2-[(2-oxo-3-phenylchromen-7-yl)oxymethyl]propyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 155262685 |
| Molecular Formula | C31H37F3O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | [3,3,3-trifluoro-2-[(2-oxo-3-phenylchromen-7-yl)oxymethyl]propyl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC(COc1ccc2cc(-c3ccccc3)c(=O)oc2c1)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C31H37F3O5/c1-28(2,3)19-30(7,29(4,5)6)27(36)38-18-22(31(32,33)34)17-37-23-14-13-21-15-24(20-11-9-8-10-12-20)26(35)39-25(21)16-23/h8-16,22H,17-19H2,1-7H3 |
| InChIKey | UVBHGZXGOBFXDF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|