C24H24F3NO4 — CID 146390865
[2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxymethyl]-3,3,3-trifluoropropyl] prop-2-enoate (PubChem CID 146390865) has the molecular formula C24H24F3NO4 and a molecular weight of 447.45 g/mol. Its IUPAC name is [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxymethyl]-3,3,3-trifluoropropyl] prop-2-enoate.
| Compound Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxymethyl]-3,3,3-trifluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390865 |
| Molecular Formula | C24H24F3NO4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxymethyl]-3,3,3-trifluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc2cc(-c3ccc(CC)nc3CC)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C24H24F3NO4/c1-4-17-8-10-19(20(5-2)28-17)22-11-15-7-9-18(12-21(15)32-22)30-13-16(24(25,26)27)14-31-23(29)6-3/h6-12,16H,3-5,13-14H2,1-2H3 |
| InChIKey | ZYOIQEWZIHMLCU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|