C20H16F3NO3S — CID 146390863
[3,3,3-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanylmethyl]propyl] prop-2-enoate (PubChem CID 146390863) has the molecular formula C20H16F3NO3S and a molecular weight of 407.41 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanylmethyl]propyl] prop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanylmethyl]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 146390863 |
| Molecular Formula | C20H16F3NO3S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [3,3,3-trifluoro-2-[(2-pyridin-3-yl-1-benzofuran-6-yl)sulfanylmethyl]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CSc1ccc2cc(-c3cccnc3)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO3S/c1-2-19(25)26-11-15(20(21,22)23)12-28-16-6-5-13-8-17(27-18(13)9-16)14-4-3-7-24-10-14/h2-10,15H,1,11-12H2 |
| InChIKey | OMZWMVYAVHZZQY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|