C20H13F3O5S — CID 140898568
[2-oxo-3-[4-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl prop-2-enoate (PubChem CID 140898568) has the molecular formula C20H13F3O5S and a molecular weight of 422.38 g/mol. Its IUPAC name is [2-oxo-3-[4-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl prop-2-enoate.
| Compound Name | [2-oxo-3-[4-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl prop-2-enoate |
|---|---|
| PubChem CID | 140898568 |
| Molecular Formula | C20H13F3O5S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | [2-oxo-3-[4-(trifluoromethoxy)phenyl]chromen-7-yl]sulfanylmethyl prop-2-enoate |
| SMILES | C=CC(=O)OCSc1ccc2cc(-c3ccc(OC(F)(F)F)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C20H13F3O5S/c1-2-18(24)26-11-29-15-8-5-13-9-16(19(25)27-17(13)10-15)12-3-6-14(7-4-12)28-20(21,22)23/h2-10H,1,11H2 |
| InChIKey | YEEHGCRSHNUYIV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|